C22H18Br2N2O5 — CID 5059554
[4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 2-(2,4-dibromophenoxy)acetate (PubChem CID 5059554) has the molecular formula C22H18Br2N2O5 and a molecular weight of 550.20 g/mol. Its IUPAC name is [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 2-(2,4-dibromophenoxy)acetate.
| Compound Name | [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 2-(2,4-dibromophenoxy)acetate |
|---|---|
| PubChem CID | 5059554 |
| Molecular Formula | C22H18Br2N2O5 |
| Molecular Weight | 550.20 g/mol |
| Exact Mass | 547.96 |
| IUPAC Name | [4-[2-cyano-3-oxo-3-(prop-2-enylamino)prop-1-enyl]-2-methoxyphenyl] 2-(2,4-dibromophenoxy)acetate |
| SMILES | C=CCNC(=O)C(C#N)=Cc1ccc(OC(=O)COc2ccc(Br)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C22H18Br2N2O5/c1-3-8-26-22(28)15(12-25)9-14-4-6-19(20(10-14)29-2)31-21(27)13-30-18-7-5-16(23)11-17(18)24/h3-7,9-11H,1,8,13H2,2H3,(H,26,28) |
| InChIKey | CWQNYVCZMJBSEJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|