C28H27BrN2O6 — CID 19180088
[4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(4-bromo-2-tert-butylphenoxy)acetate (PubChem CID 19180088) has the molecular formula C28H27BrN2O6 and a molecular weight of 567.44 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(4-bromo-2-tert-butylphenoxy)acetate.
| Compound Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(4-bromo-2-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 19180088 |
| Molecular Formula | C28H27BrN2O6 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(4-bromo-2-tert-butylphenoxy)acetate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NCc2ccco2)ccc1OC(=O)COc1ccc(Br)cc1C(C)(C)C |
| InChI | InChI=1S/C28H27BrN2O6/c1-28(2,3)22-14-20(29)8-10-23(22)36-17-26(32)37-24-9-7-18(13-25(24)34-4)12-19(15-30)27(33)31-16-21-6-5-11-35-21/h5-14H,16-17H2,1-4H3,(H,31,33)/b19-12+ |
| InChIKey | PJQWNMLIXOVMGS-XDHOZWIPSA-N |
| XLogP | 5.56 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|