C23H17FN2O5 — CID 4816129
[4-[2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 4816129) has the molecular formula C23H17FN2O5 and a molecular weight of 420.40 g/mol. Its IUPAC name is [4-[2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 4816129 |
| Molecular Formula | C23H17FN2O5 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [4-[2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1cc(C=C(C#N)C(=O)NCc2ccco2)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN2O5/c1-29-21-12-15(11-17(13-25)22(27)26-14-19-3-2-10-30-19)4-9-20(21)31-23(28)16-5-7-18(24)8-6-16/h2-12H,14H2,1H3,(H,26,27) |
| InChIKey | RBTUHLTVQYBFCV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|