C26H19N3O7 — CID 19184550
[4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 19184550) has the molecular formula C26H19N3O7 and a molecular weight of 485.45 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 19184550 |
| Molecular Formula | C26H19N3O7 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NCc2ccco2)ccc1OC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H19N3O7/c1-34-22-12-16(11-17(13-27)24(31)28-14-18-5-4-10-35-18)8-9-21(22)36-23(30)15-29-25(32)19-6-2-3-7-20(19)26(29)33/h2-12H,14-15H2,1H3,(H,28,31)/b17-11+ |
| InChIKey | BDQLFZFVTVKTMH-GZTJUZNOSA-N |
| XLogP | 2.71 |
| TPSA | 138.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|