C22H23N3O5 — CID 39974223
(E)-2-cyano-N-(furan-2-ylmethyl)-3-[3-methoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]prop-2-enamide (PubChem CID 39974223) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is (E)-2-cyano-N-(furan-2-ylmethyl)-3-[3-methoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(furan-2-ylmethyl)-3-[3-methoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 39974223 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (E)-2-cyano-N-(furan-2-ylmethyl)-3-[3-methoxy-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NCc2ccco2)ccc1OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H23N3O5/c1-28-20-12-16(6-7-19(20)30-15-21(26)25-8-2-3-9-25)11-17(13-23)22(27)24-14-18-5-4-10-29-18/h4-7,10-12H,2-3,8-9,14-15H2,1H3,(H,24,27)/b17-11+ |
| InChIKey | BOCYBQLYMCSXFP-GZTJUZNOSA-N |
| XLogP | 2.51 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|