C25H25N3O7 — CID 126199326
(E)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide (PubChem CID 126199326) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126199326 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NCc2ccc3c(c2)OCO3)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H25N3O7/c1-31-22-11-17(2-4-20(22)33-15-24(29)28-6-8-32-9-7-28)10-19(13-26)25(30)27-14-18-3-5-21-23(12-18)35-16-34-21/h2-5,10-12H,6-9,14-16H2,1H3,(H,27,30)/b19-10+ |
| InChIKey | BPVFNPVGFVIHNF-VXLYETTFSA-N |
| XLogP | 1.88 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|