C22H23N3O5 — CID 108841493
(Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-(3,4-diethoxyanilino)prop-2-enamide (PubChem CID 108841493) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-(3,4-diethoxyanilino)prop-2-enamide.
| Compound Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-(3,4-diethoxyanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108841493 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-(3,4-diethoxyanilino)prop-2-enamide |
| SMILES | CCOc1ccc(N/C=C(/C#N)C(=O)NCc2ccc3c(c2)OCO3)cc1OCC |
| InChI | InChI=1S/C22H23N3O5/c1-3-27-18-8-6-17(10-21(18)28-4-2)24-13-16(11-23)22(26)25-12-15-5-7-19-20(9-15)30-14-29-19/h5-10,13,24H,3-4,12,14H2,1-2H3,(H,25,26)/b16-13- |
| InChIKey | MWPAKEQVWWXKEG-SSZFMOIBSA-N |
| XLogP | 3.35 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|