C17H23N3O3 — CID 108820292
(Z)-2-cyano-3-(3,4-diethoxyanilino)-N-propylprop-2-enamide (PubChem CID 108820292) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,4-diethoxyanilino)-N-propylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,4-diethoxyanilino)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 108820292 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (Z)-2-cyano-3-(3,4-diethoxyanilino)-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C#N)=C\Nc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-4-9-19-17(21)13(11-18)12-20-14-7-8-15(22-5-2)16(10-14)23-6-3/h7-8,10,12,20H,4-6,9H2,1-3H3,(H,19,21)/b13-12- |
| InChIKey | IADGLZDLIZSVCD-SEYXRHQNSA-N |
| XLogP | 2.83 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|