C19H21N3O4 — CID 108863388
(Z)-2-cyano-3-(3,4-diethoxyanilino)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 108863388) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,4-diethoxyanilino)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,4-diethoxyanilino)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863388 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (Z)-2-cyano-3-(3,4-diethoxyanilino)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CCOc1ccc(N/C=C(/C#N)C(=O)NCc2ccco2)cc1OCC |
| InChI | InChI=1S/C19H21N3O4/c1-3-24-17-8-7-15(10-18(17)25-4-2)21-12-14(11-20)19(23)22-13-16-6-5-9-26-16/h5-10,12,21H,3-4,13H2,1-2H3,(H,22,23)/b14-12- |
| InChIKey | VKOPWUCICBOIKX-OWBHPGMISA-N |
| XLogP | 3.21 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|