C16H14ClN3O3 — CID 3841376
3-(5-chloro-2-methoxyanilino)-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 3841376) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyanilino)-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | 3-(5-chloro-2-methoxyanilino)-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 3841376 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-(5-chloro-2-methoxyanilino)-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC=C(C#N)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H14ClN3O3/c1-22-15-5-4-12(17)7-14(15)19-9-11(8-18)16(21)20-10-13-3-2-6-23-13/h2-7,9,19H,10H2,1H3,(H,20,21) |
| InChIKey | SOYJNMRUOSMSSE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|