C20H21ClN4O3 — CID 108859488
(Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(3,4-diethoxyanilino)prop-2-enamide (PubChem CID 108859488) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(3,4-diethoxyanilino)prop-2-enamide.
| Compound Name | (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(3,4-diethoxyanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108859488 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(3,4-diethoxyanilino)prop-2-enamide |
| SMILES | CCOc1ccc(N/C=C(/C#N)C(=O)Nc2ccc(N)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C20H21ClN4O3/c1-3-27-18-8-6-14(10-19(18)28-4-2)24-12-13(11-22)20(26)25-15-5-7-17(23)16(21)9-15/h5-10,12,24H,3-4,23H2,1-2H3,(H,25,26)/b13-12- |
| InChIKey | OQSTZDJJDMFDAU-SEYXRHQNSA-N |
| XLogP | 4.18 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|