C17H12ClF3N4O — CID 108859834
(Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-[4-(trifluoromethyl)anilino]prop-2-enamide (PubChem CID 108859834) has the molecular formula C17H12ClF3N4O and a molecular weight of 380.76 g/mol. Its IUPAC name is (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-[4-(trifluoromethyl)anilino]prop-2-enamide.
| Compound Name | (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-[4-(trifluoromethyl)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108859834 |
| Molecular Formula | C17H12ClF3N4O |
| Molecular Weight | 380.76 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-[4-(trifluoromethyl)anilino]prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(C(F)(F)F)cc1)C(=O)Nc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C17H12ClF3N4O/c18-14-7-13(5-6-15(14)23)25-16(26)10(8-22)9-24-12-3-1-11(2-4-12)17(19,20)21/h1-7,9,24H,23H2,(H,25,26)/b10-9- |
| InChIKey | XZFCFSYGSQIDDO-KTKRTIGZSA-N |
| XLogP | 4.40 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|