C13H14BrN3O — CID 108820383
(Z)-3-(3-bromoanilino)-2-cyano-N-propylprop-2-enamide (PubChem CID 108820383) has the molecular formula C13H14BrN3O and a molecular weight of 308.18 g/mol. Its IUPAC name is (Z)-3-(3-bromoanilino)-2-cyano-N-propylprop-2-enamide.
| Compound Name | (Z)-3-(3-bromoanilino)-2-cyano-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 108820383 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (Z)-3-(3-bromoanilino)-2-cyano-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C#N)=C\Nc1cccc(Br)c1 |
| InChI | InChI=1S/C13H14BrN3O/c1-2-6-16-13(18)10(8-15)9-17-12-5-3-4-11(14)7-12/h3-5,7,9,17H,2,6H2,1H3,(H,16,18)/b10-9- |
| InChIKey | DXKLQAIBDAABEK-KTKRTIGZSA-N |
| XLogP | 2.79 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|