C19H18BrN3O — CID 108850867
(Z)-3-(3-bromoanilino)-2-cyano-N-(2-ethyl-6-methylphenyl)prop-2-enamide (PubChem CID 108850867) has the molecular formula C19H18BrN3O and a molecular weight of 384.28 g/mol. Its IUPAC name is (Z)-3-(3-bromoanilino)-2-cyano-N-(2-ethyl-6-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-bromoanilino)-2-cyano-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108850867 |
| Molecular Formula | C19H18BrN3O |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (Z)-3-(3-bromoanilino)-2-cyano-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
| SMILES | CCc1cccc(C)c1NC(=O)/C(C#N)=C\Nc1cccc(Br)c1 |
| InChI | InChI=1S/C19H18BrN3O/c1-3-14-7-4-6-13(2)18(14)23-19(24)15(11-21)12-22-17-9-5-8-16(20)10-17/h4-10,12,22H,3H2,1-2H3,(H,23,24)/b15-12- |
| InChIKey | FFKHYUCQGQKGLE-QINSGFPZSA-N |
| XLogP | 4.78 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|