C20H20BrN3O — CID 108850937
(Z)-3-(4-bromo-2-methylanilino)-2-cyano-N-(2-ethyl-6-methylphenyl)prop-2-enamide (PubChem CID 108850937) has the molecular formula C20H20BrN3O and a molecular weight of 398.30 g/mol. Its IUPAC name is (Z)-3-(4-bromo-2-methylanilino)-2-cyano-N-(2-ethyl-6-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-bromo-2-methylanilino)-2-cyano-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108850937 |
| Molecular Formula | C20H20BrN3O |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (Z)-3-(4-bromo-2-methylanilino)-2-cyano-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
| SMILES | CCc1cccc(C)c1NC(=O)/C(C#N)=C\Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C20H20BrN3O/c1-4-15-7-5-6-13(2)19(15)24-20(25)16(11-22)12-23-18-9-8-17(21)10-14(18)3/h5-10,12,23H,4H2,1-3H3,(H,24,25)/b16-12- |
| InChIKey | LMJVYASGSIRQBL-VBKFSLOCSA-N |
| XLogP | 5.09 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|