C18H16BrN3O — CID 108842364
(Z)-N-benzyl-3-(4-bromo-2-methylanilino)-2-cyanoprop-2-enamide (PubChem CID 108842364) has the molecular formula C18H16BrN3O and a molecular weight of 370.25 g/mol. Its IUPAC name is (Z)-N-benzyl-3-(4-bromo-2-methylanilino)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-benzyl-3-(4-bromo-2-methylanilino)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108842364 |
| Molecular Formula | C18H16BrN3O |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (Z)-N-benzyl-3-(4-bromo-2-methylanilino)-2-cyanoprop-2-enamide |
| SMILES | Cc1cc(Br)ccc1N/C=C(/C#N)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H16BrN3O/c1-13-9-16(19)7-8-17(13)21-12-15(10-20)18(23)22-11-14-5-3-2-4-6-14/h2-9,12,21H,11H2,1H3,(H,22,23)/b15-12- |
| InChIKey | YKQKCGZOPGFRJI-QINSGFPZSA-N |
| XLogP | 3.89 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|