C22H23BrN4O — CID 108861695
(Z)-2-(4-benzylpiperazine-1-carbonyl)-3-(4-bromo-2-methylanilino)prop-2-enenitrile (PubChem CID 108861695) has the molecular formula C22H23BrN4O and a molecular weight of 439.36 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-(4-bromo-2-methylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-(4-bromo-2-methylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108861695 |
| Molecular Formula | C22H23BrN4O |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-(4-bromo-2-methylanilino)prop-2-enenitrile |
| SMILES | Cc1cc(Br)ccc1N/C=C(/C#N)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H23BrN4O/c1-17-13-20(23)7-8-21(17)25-15-19(14-24)22(28)27-11-9-26(10-12-27)16-18-5-3-2-4-6-18/h2-8,13,15,25H,9-12,16H2,1H3/b19-15- |
| InChIKey | SQKAIXIOSPKWBA-CYVLTUHYSA-N |
| XLogP | 3.92 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|