C21H23N5O — CID 108861688
(Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[(3-methyl-2-pyridinyl)amino]prop-2-enenitrile (PubChem CID 108861688) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[(3-methyl-2-pyridinyl)amino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[(3-methyl-2-pyridinyl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108861688 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[(3-methyl-2-pyridinyl)amino]prop-2-enenitrile |
| SMILES | Cc1cccnc1N/C=C(/C#N)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N5O/c1-17-6-5-9-23-20(17)24-15-19(14-22)21(27)26-12-10-25(11-13-26)16-18-7-3-2-4-8-18/h2-9,15H,10-13,16H2,1H3,(H,23,24)/b19-15- |
| InChIKey | CRYLEIFGHIFLET-CYVLTUHYSA-N |
| XLogP | 2.55 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|