C22H21N5O — CID 108861421
2-[[(Z)-3-(4-benzylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]benzonitrile (PubChem CID 108861421) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[[(Z)-3-(4-benzylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]benzonitrile.
| Compound Name | 2-[[(Z)-3-(4-benzylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]benzonitrile |
|---|---|
| PubChem CID | 108861421 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[[(Z)-3-(4-benzylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]amino]benzonitrile |
| SMILES | N#C/C(=C/Nc1ccccc1C#N)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H21N5O/c23-14-19-8-4-5-9-21(19)25-16-20(15-24)22(28)27-12-10-26(11-13-27)17-18-6-2-1-3-7-18/h1-9,16,25H,10-13,17H2/b20-16- |
| InChIKey | FNEZAKBQDMWMJR-SILNSSARSA-N |
| XLogP | 2.72 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|