C17H22ClN5O — CID 108863972
(Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(4-chloro-2-methylanilino)prop-2-enenitrile (PubChem CID 108863972) has the molecular formula C17H22ClN5O and a molecular weight of 347.85 g/mol. Its IUPAC name is (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(4-chloro-2-methylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(4-chloro-2-methylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108863972 |
| Molecular Formula | C17H22ClN5O |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(4-chloro-2-methylanilino)prop-2-enenitrile |
| SMILES | Cc1cc(Cl)ccc1N/C=C(/C#N)C(=O)N1CCN(CCN)CC1 |
| InChI | InChI=1S/C17H22ClN5O/c1-13-10-15(18)2-3-16(13)21-12-14(11-20)17(24)23-8-6-22(5-4-19)7-9-23/h2-3,10,12,21H,4-9,19H2,1H3/b14-12- |
| InChIKey | DSMZXLQYTIFFGU-OWBHPGMISA-N |
| XLogP | 1.57 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|