C18H25N5O — CID 108863840
(Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(2,3-dimethylanilino)prop-2-enenitrile (PubChem CID 108863840) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(2,3-dimethylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(2,3-dimethylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108863840 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(2,3-dimethylanilino)prop-2-enenitrile |
| SMILES | Cc1cccc(N/C=C(/C#N)C(=O)N2CCN(CCN)CC2)c1C |
| InChI | InChI=1S/C18H25N5O/c1-14-4-3-5-17(15(14)2)21-13-16(12-20)18(24)23-10-8-22(7-6-19)9-11-23/h3-5,13,21H,6-11,19H2,1-2H3/b16-13- |
| InChIKey | BPKGZSWGRJCLHM-SSZFMOIBSA-N |
| XLogP | 1.23 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|