C14H20N6OS — CID 108863892
(Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enenitrile (PubChem CID 108863892) has the molecular formula C14H20N6OS and a molecular weight of 320.42 g/mol. Its IUPAC name is (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108863892 |
| Molecular Formula | C14H20N6OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enenitrile |
| SMILES | Cc1csc(N/C=C(/C#N)C(=O)N2CCN(CCN)CC2)n1 |
| InChI | InChI=1S/C14H20N6OS/c1-11-10-22-14(18-11)17-9-12(8-16)13(21)20-6-4-19(3-2-15)5-7-20/h9-10H,2-7,15H2,1H3,(H,17,18)/b12-9- |
| InChIKey | YBEDKDNTIWJIIV-XFXZXTDPSA-N |
| XLogP | 0.37 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|