C15H20N6O — CID 108864006
(Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(pyridin-3-ylamino)prop-2-enenitrile (PubChem CID 108864006) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(pyridin-3-ylamino)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(pyridin-3-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108864006 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (Z)-2-[4-(2-aminoethyl)piperazine-1-carbonyl]-3-(pyridin-3-ylamino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1cccnc1)C(=O)N1CCN(CCN)CC1 |
| InChI | InChI=1S/C15H20N6O/c16-3-5-20-6-8-21(9-7-20)15(22)13(10-17)11-19-14-2-1-4-18-12-14/h1-2,4,11-12,19H,3,5-9,16H2/b13-11- |
| InChIKey | AQQMLOAFNKMTKI-QBFSEMIESA-N |
| XLogP | 0.00 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|