C17H24N6O3S — CID 108863908
4-[[[(Z)-3-[4-(2-aminoethyl)piperazin-1-yl]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzenesulfonamide (PubChem CID 108863908) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is 4-[[[(Z)-3-[4-(2-aminoethyl)piperazin-1-yl]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[(Z)-3-[4-(2-aminoethyl)piperazin-1-yl]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 108863908 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 4-[[[(Z)-3-[4-(2-aminoethyl)piperazin-1-yl]-2-cyano-3-oxoprop-1-enyl]amino]methyl]benzenesulfonamide |
| SMILES | N#C/C(=C/NCc1ccc(S(N)(=O)=O)cc1)C(=O)N1CCN(CCN)CC1 |
| InChI | InChI=1S/C17H24N6O3S/c18-5-6-22-7-9-23(10-8-22)17(24)15(11-19)13-21-12-14-1-3-16(4-2-14)27(20,25)26/h1-4,13,21H,5-10,12,18H2,(H2,20,25,26)/b15-13- |
| InChIKey | LTMYWYLMQQYVQQ-SQFISAMPSA-N |
| XLogP | -1.07 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|