C15H18N4O5S — CID 108845931
4-[[(Z)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]prop-2-enoyl]amino]butanoic acid (PubChem CID 108845931) has the molecular formula C15H18N4O5S and a molecular weight of 366.40 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]prop-2-enoyl]amino]butanoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108845931 |
| Molecular Formula | C15H18N4O5S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]prop-2-enoyl]amino]butanoic acid |
| SMILES | N#C/C(=C/NCc1ccc(S(N)(=O)=O)cc1)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H18N4O5S/c16-8-12(15(22)19-7-1-2-14(20)21)10-18-9-11-3-5-13(6-4-11)25(17,23)24/h3-6,10,18H,1-2,7,9H2,(H,19,22)(H,20,21)(H2,17,23,24)/b12-10- |
| InChIKey | KZTVNFNNIQBMHT-BENRWUELSA-N |
| XLogP | -0.19 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|