C17H14Cl2N4O3S — CID 108821788
(Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide (PubChem CID 108821788) has the molecular formula C17H14Cl2N4O3S and a molecular weight of 425.30 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108821788 |
| Molecular Formula | C17H14Cl2N4O3S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide |
| SMILES | N#C/C(=C/NCc1ccc(S(N)(=O)=O)cc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N4O3S/c18-15-6-3-13(7-16(15)19)23-17(24)12(8-20)10-22-9-11-1-4-14(5-2-11)27(21,25)26/h1-7,10,22H,9H2,(H,23,24)(H2,21,25,26)/b12-10- |
| InChIKey | FFOCXXQMPAUJNL-BENRWUELSA-N |
| XLogP | 2.78 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|