C14H17ClN4O3S — CID 108854127
(Z)-N-(3-chloropropyl)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide (PubChem CID 108854127) has the molecular formula C14H17ClN4O3S and a molecular weight of 356.84 g/mol. Its IUPAC name is (Z)-N-(3-chloropropyl)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide.
| Compound Name | (Z)-N-(3-chloropropyl)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108854127 |
| Molecular Formula | C14H17ClN4O3S |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (Z)-N-(3-chloropropyl)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide |
| SMILES | N#C/C(=C/NCc1ccc(S(N)(=O)=O)cc1)C(=O)NCCCCl |
| InChI | InChI=1S/C14H17ClN4O3S/c15-6-1-7-19-14(20)12(8-16)10-18-9-11-2-4-13(5-3-11)23(17,21)22/h2-5,10,18H,1,6-7,9H2,(H,19,20)(H2,17,21,22)/b12-10- |
| InChIKey | HENAWKCFWGRKET-BENRWUELSA-N |
| XLogP | 0.58 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|