C17H22ClN3O — CID 108854339
(Z)-N-(3-chloropropyl)-2-cyano-3-(4-phenylbutylamino)prop-2-enamide (PubChem CID 108854339) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is (Z)-N-(3-chloropropyl)-2-cyano-3-(4-phenylbutylamino)prop-2-enamide.
| Compound Name | (Z)-N-(3-chloropropyl)-2-cyano-3-(4-phenylbutylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108854339 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (Z)-N-(3-chloropropyl)-2-cyano-3-(4-phenylbutylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NCCCCc1ccccc1)C(=O)NCCCCl |
| InChI | InChI=1S/C17H22ClN3O/c18-10-6-12-21-17(22)16(13-19)14-20-11-5-4-9-15-7-2-1-3-8-15/h1-3,7-8,14,20H,4-6,9-12H2,(H,21,22)/b16-14- |
| InChIKey | UKIAKXICAAERSR-PEZBUJJGSA-N |
| XLogP | 2.75 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|