C15H17ClFN3O — CID 108854320
(Z)-N-(3-chloropropyl)-2-cyano-3-[2-(2-fluorophenyl)ethylamino]prop-2-enamide (PubChem CID 108854320) has the molecular formula C15H17ClFN3O and a molecular weight of 309.77 g/mol. Its IUPAC name is (Z)-N-(3-chloropropyl)-2-cyano-3-[2-(2-fluorophenyl)ethylamino]prop-2-enamide.
| Compound Name | (Z)-N-(3-chloropropyl)-2-cyano-3-[2-(2-fluorophenyl)ethylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108854320 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (Z)-N-(3-chloropropyl)-2-cyano-3-[2-(2-fluorophenyl)ethylamino]prop-2-enamide |
| SMILES | N#C/C(=C/NCCc1ccccc1F)C(=O)NCCCCl |
| InChI | InChI=1S/C15H17ClFN3O/c16-7-3-8-20-15(21)13(10-18)11-19-9-6-12-4-1-2-5-14(12)17/h1-2,4-5,11,19H,3,6-9H2,(H,20,21)/b13-11- |
| InChIKey | DZSWFUCDATZTGE-QBFSEMIESA-N |
| XLogP | 2.11 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|