C18H24N4O5S — CID 108845281
6-[[(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enoyl]amino]hexanoic acid (PubChem CID 108845281) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is 6-[[(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 108845281 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 6-[[(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enoyl]amino]hexanoic acid |
| SMILES | N#C/C(=C/NCCc1ccc(S(N)(=O)=O)cc1)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C18H24N4O5S/c19-12-15(18(25)22-10-3-1-2-4-17(23)24)13-21-11-9-14-5-7-16(8-6-14)28(20,26)27/h5-8,13,21H,1-4,9-11H2,(H,22,25)(H,23,24)(H2,20,26,27)/b15-13- |
| InChIKey | PJDQYBDQCMMQAO-SQFISAMPSA-N |
| XLogP | 0.63 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|