C18H26N6O3S — CID 108864101
(Z)-2-cyano-N-(2-piperazin-1-ylethyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide (PubChem CID 108864101) has the molecular formula C18H26N6O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-piperazin-1-ylethyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-piperazin-1-ylethyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108864101 |
| Molecular Formula | C18H26N6O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (Z)-2-cyano-N-(2-piperazin-1-ylethyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide |
| SMILES | N#C/C(=C/NCCc1ccc(S(N)(=O)=O)cc1)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H26N6O3S/c19-13-16(18(25)23-9-12-24-10-7-21-8-11-24)14-22-6-5-15-1-3-17(4-2-15)28(20,26)27/h1-4,14,21-22H,5-12H2,(H,23,25)(H2,20,26,27)/b16-14- |
| InChIKey | MSLKBIRUDNUCIM-PEZBUJJGSA-N |
| XLogP | -1.11 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|