C21H24N4O3S — CID 108851249
(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 108851249) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108851249 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)/C(C#N)=C\NCCc2ccc(S(N)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-14-10-15(2)20(16(3)11-14)25-21(26)18(12-22)13-24-9-8-17-4-6-19(7-5-17)29(23,27)28/h4-7,10-11,13,24H,8-9H2,1-3H3,(H,25,26)(H2,23,27,28)/b18-13- |
| InChIKey | UMHSTDFNHGTNHA-AQTBWJFISA-N |
| XLogP | 2.44 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|