C19H19IN4O3S — CID 108860187
(Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide (PubChem CID 108860187) has the molecular formula C19H19IN4O3S and a molecular weight of 510.36 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108860187 |
| Molecular Formula | C19H19IN4O3S |
| Molecular Weight | 510.36 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enamide |
| SMILES | Cc1cc(I)ccc1NC(=O)/C(C#N)=C\NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H19IN4O3S/c1-13-10-16(20)4-7-18(13)24-19(25)15(11-21)12-23-9-8-14-2-5-17(6-3-14)28(22,26)27/h2-7,10,12,23H,8-9H2,1H3,(H,24,25)(H2,22,26,27)/b15-12- |
| InChIKey | RLBCUIHJXRUYAE-QINSGFPZSA-N |
| XLogP | 2.43 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|