C20H20IN3O — CID 108860282
(Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-[2-(2-methylphenyl)ethylamino]prop-2-enamide (PubChem CID 108860282) has the molecular formula C20H20IN3O and a molecular weight of 445.30 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-[2-(2-methylphenyl)ethylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-[2-(2-methylphenyl)ethylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108860282 |
| Molecular Formula | C20H20IN3O |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | (Z)-2-cyano-N-(4-iodo-2-methylphenyl)-3-[2-(2-methylphenyl)ethylamino]prop-2-enamide |
| SMILES | Cc1ccccc1CCN/C=C(/C#N)C(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C20H20IN3O/c1-14-5-3-4-6-16(14)9-10-23-13-17(12-22)20(25)24-19-8-7-18(21)11-15(19)2/h3-8,11,13,23H,9-10H2,1-2H3,(H,24,25)/b17-13- |
| InChIKey | GRRIDODFVBWLFX-LGMDPLHJSA-N |
| XLogP | 4.09 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|