C14H13IN4O — CID 108860305
(Z)-2-cyano-3-(2-cyanoethylamino)-N-(4-iodo-2-methylphenyl)prop-2-enamide (PubChem CID 108860305) has the molecular formula C14H13IN4O and a molecular weight of 380.19 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-cyanoethylamino)-N-(4-iodo-2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-cyanoethylamino)-N-(4-iodo-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108860305 |
| Molecular Formula | C14H13IN4O |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | (Z)-2-cyano-3-(2-cyanoethylamino)-N-(4-iodo-2-methylphenyl)prop-2-enamide |
| SMILES | Cc1cc(I)ccc1NC(=O)/C(C#N)=C\NCCC#N |
| InChI | InChI=1S/C14H13IN4O/c1-10-7-12(15)3-4-13(10)19-14(20)11(8-17)9-18-6-2-5-16/h3-4,7,9,18H,2,6H2,1H3,(H,19,20)/b11-9- |
| InChIKey | OMYCCCAIMLQYBQ-LUAWRHEFSA-N |
| XLogP | 2.45 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|