C23H26IN3O3 — CID 108860180
(Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-(4-iodo-2-methylphenyl)prop-2-enamide (PubChem CID 108860180) has the molecular formula C23H26IN3O3 and a molecular weight of 519.38 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-(4-iodo-2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-(4-iodo-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108860180 |
| Molecular Formula | C23H26IN3O3 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-(4-iodo-2-methylphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(CCN/C=C(/C#N)C(=O)Nc2ccc(I)cc2C)cc1OCC |
| InChI | InChI=1S/C23H26IN3O3/c1-4-29-21-9-6-17(13-22(21)30-5-2)10-11-26-15-18(14-25)23(28)27-20-8-7-19(24)12-16(20)3/h6-9,12-13,15,26H,4-5,10-11H2,1-3H3,(H,27,28)/b18-15- |
| InChIKey | ALPMDQRUFFJNHJ-SDXDJHTJSA-N |
| XLogP | 4.58 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|