C23H27N3O3 — CID 108821504
(Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-(2-methylphenyl)prop-2-enamide (PubChem CID 108821504) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108821504 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (Z)-2-cyano-3-[2-(3,4-diethoxyphenyl)ethylamino]-N-(2-methylphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(CCN/C=C(/C#N)C(=O)Nc2ccccc2C)cc1OCC |
| InChI | InChI=1S/C23H27N3O3/c1-4-28-21-11-10-18(14-22(21)29-5-2)12-13-25-16-19(15-24)23(27)26-20-9-7-6-8-17(20)3/h6-11,14,16,25H,4-5,12-13H2,1-3H3,(H,26,27)/b19-16- |
| InChIKey | ALJANNZTCUUYJB-MNDPQUGUSA-N |
| XLogP | 3.97 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|