C22H24N2O3 — CID 2382177
(Z)-2-cyano-N-[2-(3,4-diethoxyphenyl)ethyl]-3-phenylprop-2-enamide (PubChem CID 2382177) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (Z)-2-cyano-N-[2-(3,4-diethoxyphenyl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[2-(3,4-diethoxyphenyl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2382177 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (Z)-2-cyano-N-[2-(3,4-diethoxyphenyl)ethyl]-3-phenylprop-2-enamide |
| SMILES | CCOc1ccc(CCNC(=O)/C(C#N)=C\c2ccccc2)cc1OCC |
| InChI | InChI=1S/C22H24N2O3/c1-3-26-20-11-10-18(15-21(20)27-4-2)12-13-24-22(25)19(16-23)14-17-8-6-5-7-9-17/h5-11,14-15H,3-4,12-13H2,1-2H3,(H,24,25)/b19-14- |
| InChIKey | SDLPGVINXHBTKP-RGEXLXHISA-N |
| XLogP | 3.75 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|