C19H17IN2O2 — CID 6526761
(E)-N-benzyl-2-cyano-3-(4-ethoxy-3-iodophenyl)prop-2-enamide (PubChem CID 6526761) has the molecular formula C19H17IN2O2 and a molecular weight of 432.26 g/mol. Its IUPAC name is (E)-N-benzyl-2-cyano-3-(4-ethoxy-3-iodophenyl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-2-cyano-3-(4-ethoxy-3-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6526761 |
| Molecular Formula | C19H17IN2O2 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | (E)-N-benzyl-2-cyano-3-(4-ethoxy-3-iodophenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C(\C#N)C(=O)NCc2ccccc2)cc1I |
| InChI | InChI=1S/C19H17IN2O2/c1-2-24-18-9-8-15(11-17(18)20)10-16(12-21)19(23)22-13-14-6-4-3-5-7-14/h3-11H,2,13H2,1H3,(H,22,23)/b16-10+ |
| InChIKey | GOSRXRYGGFJFRH-MHWRWJLKSA-N |
| XLogP | 3.91 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|