C21H19BrN2O5 — CID 126048317
2-[4-[(E)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2-bromo-6-ethoxyphenoxy]acetic acid (PubChem CID 126048317) has the molecular formula C21H19BrN2O5 and a molecular weight of 459.30 g/mol. Its IUPAC name is 2-[4-[(E)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2-bromo-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2-bromo-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126048317 |
| Molecular Formula | C21H19BrN2O5 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 2-[4-[(E)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2-bromo-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)NCc2ccccc2)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C21H19BrN2O5/c1-2-28-18-10-15(9-17(22)20(18)29-13-19(25)26)8-16(11-23)21(27)24-12-14-6-4-3-5-7-14/h3-10H,2,12-13H2,1H3,(H,24,27)(H,25,26)/b16-8+ |
| InChIKey | KOEXPASBPBMTIZ-LZYBPNLTSA-N |
| XLogP | 3.53 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|