C24H23BrN2O3 — CID 126237573
(Z)-3-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126237573) has the molecular formula C24H23BrN2O3 and a molecular weight of 467.36 g/mol. Its IUPAC name is (Z)-3-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126237573 |
| Molecular Formula | C24H23BrN2O3 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | (Z)-3-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | C#CCOc1c(Br)cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)cc1OCC |
| InChI | InChI=1S/C24H23BrN2O3/c1-3-13-30-23-21(25)15-19(16-22(23)29-4-2)14-20(17-26)24(28)27-12-8-11-18-9-6-5-7-10-18/h1,5-7,9-10,14-16H,4,8,11-13H2,2H3,(H,27,28)/b20-14- |
| InChIKey | CREXTKCKSFEOMJ-ZHZULCJRSA-N |
| XLogP | 4.52 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|