C29H29ClN2O3 — CID 126235969
(Z)-3-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126235969) has the molecular formula C29H29ClN2O3 and a molecular weight of 489.02 g/mol. Its IUPAC name is (Z)-3-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126235969 |
| Molecular Formula | C29H29ClN2O3 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (Z)-3-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)cc(Cl)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C29H29ClN2O3/c1-3-34-27-18-24(17-26(30)28(27)35-20-23-13-11-21(2)12-14-23)16-25(19-31)29(33)32-15-7-10-22-8-5-4-6-9-22/h4-6,8-9,11-14,16-18H,3,7,10,15,20H2,1-2H3,(H,32,33)/b25-16- |
| InChIKey | UWDIXHRQENWBRQ-XYGWBWBKSA-N |
| XLogP | 6.28 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|