C23H22Cl2N2O4 — CID 126247112
ethyl 2-[2,6-dichloro-4-[(Z)-2-cyano-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]phenoxy]acetate (PubChem CID 126247112) has the molecular formula C23H22Cl2N2O4 and a molecular weight of 461.35 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(Z)-2-cyano-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(Z)-2-cyano-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126247112 |
| Molecular Formula | C23H22Cl2N2O4 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(Z)-2-cyano-3-oxo-3-(3-phenylpropylamino)prop-1-enyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O4/c1-2-30-21(28)15-31-22-19(24)12-17(13-20(22)25)11-18(14-26)23(29)27-10-6-9-16-7-4-3-5-8-16/h3-5,7-8,11-13H,2,6,9-10,15H2,1H3,(H,27,29)/b18-11- |
| InChIKey | VMLFITTXVQTXQG-WQRHYEAKSA-N |
| XLogP | 4.59 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|