C26H21Br2ClN2O2 — CID 126254199
(Z)-2-cyano-3-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126254199) has the molecular formula C26H21Br2ClN2O2 and a molecular weight of 588.73 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126254199 |
| Molecular Formula | C26H21Br2ClN2O2 |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 585.97 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Br)c(OCc2ccc(Cl)cc2)c(Br)c1)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C26H21Br2ClN2O2/c27-23-14-20(15-24(28)25(23)33-17-19-8-10-22(29)11-9-19)13-21(16-30)26(32)31-12-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-11,13-15H,4,7,12,17H2,(H,31,32)/b21-13- |
| InChIKey | JNQVIDASYQZOCD-BKUYFWCQSA-N |
| XLogP | 7.10 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|