C24H17Br2ClN2O2 — CID 126048987
(E)-N-benzyl-2-cyano-3-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 126048987) has the molecular formula C24H17Br2ClN2O2 and a molecular weight of 560.67 g/mol. Its IUPAC name is (E)-N-benzyl-2-cyano-3-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-2-cyano-3-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126048987 |
| Molecular Formula | C24H17Br2ClN2O2 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 557.93 |
| IUPAC Name | (E)-N-benzyl-2-cyano-3-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1OCc1ccc(Cl)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H17Br2ClN2O2/c25-20-11-18(10-19(13-28)24(30)29-14-16-4-2-1-3-5-16)23(22(26)12-20)31-15-17-6-8-21(27)9-7-17/h1-12H,14-15H2,(H,29,30)/b19-10+ |
| InChIKey | NIDDVJLDYDUHNB-VXLYETTFSA-N |
| XLogP | 6.67 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|