C23H19Br2N3O2 — CID 126379521
(Z)-2-cyano-3-(3,5-dibromo-2-phenylmethoxyphenyl)-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide (PubChem CID 126379521) has the molecular formula C23H19Br2N3O2 and a molecular weight of 529.23 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dibromo-2-phenylmethoxyphenyl)-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dibromo-2-phenylmethoxyphenyl)-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126379521 |
| Molecular Formula | C23H19Br2N3O2 |
| Molecular Weight | 529.23 g/mol |
| Exact Mass | 526.98 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dibromo-2-phenylmethoxyphenyl)-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
| SMILES | Cc1ccc(C)n1NC(=O)/C(C#N)=C\c1cc(Br)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H19Br2N3O2/c1-15-8-9-16(2)28(15)27-23(29)19(13-26)10-18-11-20(24)12-21(25)22(18)30-14-17-6-4-3-5-7-17/h3-12H,14H2,1-2H3,(H,27,29)/b19-10- |
| InChIKey | BTHIHOXBXRLNBR-GRSHGNNSSA-N |
| XLogP | 5.89 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.23 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|