C25H18Br2N2O5 — CID 126077703
4-[[2,4-dibromo-6-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]phenoxy]methyl]benzoic acid (PubChem CID 126077703) has the molecular formula C25H18Br2N2O5 and a molecular weight of 586.24 g/mol. Its IUPAC name is 4-[[2,4-dibromo-6-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,4-dibromo-6-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126077703 |
| Molecular Formula | C25H18Br2N2O5 |
| Molecular Weight | 586.24 g/mol |
| Exact Mass | 583.96 |
| IUPAC Name | 4-[[2,4-dibromo-6-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C/c2cc(Br)cc(Br)c2OCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H18Br2N2O5/c1-33-21-8-6-20(7-9-21)29-24(30)18(13-28)10-17-11-19(26)12-22(27)23(17)34-14-15-2-4-16(5-3-15)25(31)32/h2-12H,14H2,1H3,(H,29,30)(H,31,32)/b18-10+ |
| InChIKey | JHBOUOVFVLYNFZ-VCHYOVAHSA-N |
| XLogP | 6.04 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.24 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|