C25H17Br2F3N2O2 — CID 126052677
(E)-2-cyano-3-[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126052677) has the molecular formula C25H17Br2F3N2O2 and a molecular weight of 594.23 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126052677 |
| Molecular Formula | C25H17Br2F3N2O2 |
| Molecular Weight | 594.23 g/mol |
| Exact Mass | 591.96 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(COc2c(Br)cc(Br)cc2/C=C(\C#N)C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H17Br2F3N2O2/c1-15-5-7-16(8-6-15)14-34-23-17(10-20(26)12-22(23)27)9-18(13-31)24(33)32-21-4-2-3-19(11-21)25(28,29)30/h2-12H,14H2,1H3,(H,32,33)/b18-9+ |
| InChIKey | JPIYIKKMYMSPAD-GIJQJNRQSA-N |
| XLogP | 7.66 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.23 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|