C24H15Cl2F3N2O2 — CID 126045003
(E)-2-cyano-3-(3,5-dichloro-2-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126045003) has the molecular formula C24H15Cl2F3N2O2 and a molecular weight of 491.30 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-dichloro-2-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-dichloro-2-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126045003 |
| Molecular Formula | C24H15Cl2F3N2O2 |
| Molecular Weight | 491.30 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | (E)-2-cyano-3-(3,5-dichloro-2-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Cl)cc(Cl)c1OCc1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H15Cl2F3N2O2/c25-19-10-16(22(21(26)12-19)33-14-15-5-2-1-3-6-15)9-17(13-30)23(32)31-20-8-4-7-18(11-20)24(27,28)29/h1-12H,14H2,(H,31,32)/b17-9+ |
| InChIKey | AAGDFHVYQXMHHP-RQZCQDPDSA-N |
| XLogP | 7.14 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.30 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|