C25H17F3N2O4 — CID 1278488
5-[(Z)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-phenylmethoxybenzoic acid (PubChem CID 1278488) has the molecular formula C25H17F3N2O4 and a molecular weight of 466.42 g/mol. Its IUPAC name is 5-[(Z)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-phenylmethoxybenzoic acid.
| Compound Name | 5-[(Z)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 1278488 |
| Molecular Formula | C25H17F3N2O4 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 5-[(Z)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-phenylmethoxybenzoic acid |
| SMILES | N#C/C(=C/c1ccc(OCc2ccccc2)c(C(=O)O)c1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H17F3N2O4/c26-25(27,28)19-7-4-8-20(13-19)30-23(31)18(14-29)11-17-9-10-22(21(12-17)24(32)33)34-15-16-5-2-1-3-6-16/h1-13H,15H2,(H,30,31)(H,32,33)/b18-11- |
| InChIKey | XDOIKUIPMBNORI-WQRHYEAKSA-N |
| XLogP | 5.53 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|